C22H20O4 — CID 25116115
5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-2-phenylchromen-4-one (PubChem CID 25116115) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 25116115 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 5,7-dihydroxy-3-[(2E)-5-methylhexa-2,4-dienyl]-2-phenylchromen-4-one |
| SMILES | CC(C)=C/C=C/Cc1c(-c2ccccc2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C22H20O4/c1-14(2)8-6-7-11-17-21(25)20-18(24)12-16(23)13-19(20)26-22(17)15-9-4-3-5-10-15/h3-10,12-13,23-24H,11H2,1-2H3/b7-6+ |
| InChIKey | AZPDIROMJOBTJA-VOTSOKGWSA-N |
| XLogP | 4.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|