C17H14O9 — CID 22138200
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(2,2,2-trihydroxyethyl)chromen-4-one (PubChem CID 22138200) has the molecular formula C17H14O9 and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(2,2,2-trihydroxyethyl)chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(2,2,2-trihydroxyethyl)chromen-4-one |
|---|---|
| PubChem CID | 22138200 |
| Molecular Formula | C17H14O9 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(2,2,2-trihydroxyethyl)chromen-4-one |
| SMILES | O=c1c(CC(O)(O)O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C17H14O9/c18-8-4-12(21)14-13(5-8)26-16(7-1-2-10(19)11(20)3-7)9(15(14)22)6-17(23,24)25/h1-5,18-21,23-25H,6H2 |
| InChIKey | AEPKCDDUSOEDDO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|