C19H16O13 — CID 163010027
(10R,13S,14R,15R)-3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione (PubChem CID 163010027) has the molecular formula C19H16O13 and a molecular weight of 452.32 g/mol. Its IUPAC name is (10R,13S,14R,15R)-3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione.
| Compound Name | (10R,13S,14R,15R)-3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione |
|---|---|
| PubChem CID | 163010027 |
| Molecular Formula | C19H16O13 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (10R,13S,14R,15R)-3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione |
| SMILES | O=C1O[C@@H]2[C@@H](O)[C@@H](O)OC[C@H]2OC(=O)c2cc(O)c(O)c(O)c2-c2c1cc(O)c(O)c2O |
| InChI | InChI=1S/C19H16O13/c20-6-1-4-9(13(24)11(6)22)10-5(2-7(21)12(23)14(10)25)18(28)32-16-8(31-17(4)27)3-30-19(29)15(16)26/h1-2,8,15-16,19-26,29H,3H2/t8-,15-,16+,19+/m1/s1 |
| InChIKey | ZKBLUASIGJJVPP-VJDKZVTKSA-N |
| XLogP | -0.64 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|