C27H22O14 — CID 102291509
(1R,18S,19R,24R)-6,7,8,11,12,13,26-heptahydroxy-21-phenyl-2,17,20,22,25-pentaoxapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4,6,8,10,12,14-hexaene-3,16-dione (PubChem CID 102291509) has the molecular formula C27H22O14 and a molecular weight of 570.46 g/mol. Its IUPAC name is (1R,18S,19R,24R)-6,7,8,11,12,13,26-heptahydroxy-21-phenyl-2,17,20,22,25-pentaoxapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4,6,8,10,12,14-hexaene-3,16-dione.
| Compound Name | (1R,18S,19R,24R)-6,7,8,11,12,13,26-heptahydroxy-21-phenyl-2,17,20,22,25-pentaoxapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4,6,8,10,12,14-hexaene-3,16-dione |
|---|---|
| PubChem CID | 102291509 |
| Molecular Formula | C27H22O14 |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | (1R,18S,19R,24R)-6,7,8,11,12,13,26-heptahydroxy-21-phenyl-2,17,20,22,25-pentaoxapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4,6,8,10,12,14-hexaene-3,16-dione |
| SMILES | O=C1O[C@H]2[C@@H]3OC(c4ccccc4)OC[C@H]3OC(O)[C@@H]2OC(=O)c2cc(O)c(O)c(O)c2-c2c1cc(O)c(O)c2O |
| InChI | InChI=1S/C27H22O14/c28-12-6-10-15(19(32)17(12)30)16-11(7-13(29)18(31)20(16)33)25(35)40-23-22(39-24(10)34)21-14(38-26(23)36)8-37-27(41-21)9-4-2-1-3-5-9/h1-7,14,21-23,26-33,36H,8H2/t14-,21-,22+,23-,26?,27?/m1/s1 |
| InChIKey | NFGBTLKLLDPYIG-UFLCBOMUSA-N |
| XLogP | 1.48 |
| TPSA | 221.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|