C18H14O7 — CID 15118832
7-hydroxy-4,10-dimethoxy-8-methylnaphtho[3,2-g][1,3]benzodioxole-6,11-dione (PubChem CID 15118832) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is 7-hydroxy-4,10-dimethoxy-8-methylnaphtho[3,2-g][1,3]benzodioxole-6,11-dione.
| Compound Name | 7-hydroxy-4,10-dimethoxy-8-methylnaphtho[3,2-g][1,3]benzodioxole-6,11-dione |
|---|---|
| PubChem CID | 15118832 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 7-hydroxy-4,10-dimethoxy-8-methylnaphtho[3,2-g][1,3]benzodioxole-6,11-dione |
| SMILES | COc1cc2c(c3c1OCO3)C(=O)c1c(OC)cc(C)c(O)c1C2=O |
| InChI | InChI=1S/C18H14O7/c1-7-4-9(22-2)12-13(14(7)19)15(20)8-5-10(23-3)17-18(25-6-24-17)11(8)16(12)21/h4-5,19H,6H2,1-3H3 |
| InChIKey | GYMHJZVSDZYFMA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|