C22H23NO7 — CID 59053122
12-butyl-8,16-dimethoxy-4,6,18,20-tetraoxa-12-azapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one (PubChem CID 59053122) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is 12-butyl-8,16-dimethoxy-4,6,18,20-tetraoxa-12-azapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one.
| Compound Name | 12-butyl-8,16-dimethoxy-4,6,18,20-tetraoxa-12-azapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one |
|---|---|
| PubChem CID | 59053122 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 12-butyl-8,16-dimethoxy-4,6,18,20-tetraoxa-12-azapentacyclo[12.7.0.02,10.03,7.017,21]henicosa-1(21),2,7,9,14,16-hexaen-11-one |
| SMILES | CCCCN1Cc2cc(OC)c3c(c2-c2c(cc(OC)c4c2OCO4)C1=O)OCO3 |
| InChI | InChI=1S/C22H23NO7/c1-4-5-6-23-9-12-7-14(25-2)18-20(29-10-27-18)16(12)17-13(22(23)24)8-15(26-3)19-21(17)30-11-28-19/h7-8H,4-6,9-11H2,1-3H3 |
| InChIKey | HPWLHEDILCRWDF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |