C21H33NO3 — CID 91505734
5,6-dihexoxy-2-methyl-3H-isoindol-1-one (PubChem CID 91505734) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 5,6-dihexoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | 5,6-dihexoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 91505734 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 5,6-dihexoxy-2-methyl-3H-isoindol-1-one |
| SMILES | CCCCCCOc1cc2c(cc1OCCCCCC)C(=O)N(C)C2 |
| InChI | InChI=1S/C21H33NO3/c1-4-6-8-10-12-24-19-14-17-16-22(3)21(23)18(17)15-20(19)25-13-11-9-7-5-2/h14-15H,4-13,16H2,1-3H3 |
| InChIKey | PPBBZHJFQXDMDS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|