C23H29NO4 — CID 19363245
2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-7-pentoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 19363245) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-7-pentoxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-7-pentoxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 19363245 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-7-pentoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCCCOc1cc2c(cc1OC)CCN(CCc1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C23H29NO4/c1-3-4-5-14-28-22-16-20-18(15-21(22)27-2)11-13-24(23(20)26)12-10-17-6-8-19(25)9-7-17/h6-9,15-16,25H,3-5,10-14H2,1-2H3 |
| InChIKey | AZUNJJKCJSMMAR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|