C26H37ClN2O3 — CID 19363240
2-[2-(4-aminophenyl)ethyl]-4,5-dipentoxy-3H-isoindol-1-one;hydrochloride (PubChem CID 19363240) has the molecular formula C26H37ClN2O3 and a molecular weight of 461.05 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)ethyl]-4,5-dipentoxy-3H-isoindol-1-one;hydrochloride.
| Compound Name | 2-[2-(4-aminophenyl)ethyl]-4,5-dipentoxy-3H-isoindol-1-one;hydrochloride |
|---|---|
| PubChem CID | 19363240 |
| Molecular Formula | C26H37ClN2O3 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-[2-(4-aminophenyl)ethyl]-4,5-dipentoxy-3H-isoindol-1-one;hydrochloride |
| SMILES | CCCCCOc1ccc2c(c1OCCCCC)CN(CCc1ccc(N)cc1)C2=O.Cl |
| InChI | InChI=1S/C26H36N2O3.ClH/c1-3-5-7-17-30-24-14-13-22-23(25(24)31-18-8-6-4-2)19-28(26(22)29)16-15-20-9-11-21(27)12-10-20;/h9-14H,3-8,15-19,27H2,1-2H3;1H |
| InChIKey | BIRZBJWEISOVKB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|