C26H36ClN3O6 — CID 86739859
3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-5-hydroxyimino-7,8-dimethoxy-1,2-dihydro-3-benzazepin-4-one;hydrochloride (PubChem CID 86739859) has the molecular formula C26H36ClN3O6 and a molecular weight of 522.04 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-5-hydroxyimino-7,8-dimethoxy-1,2-dihydro-3-benzazepin-4-one;hydrochloride.
| Compound Name | 3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-5-hydroxyimino-7,8-dimethoxy-1,2-dihydro-3-benzazepin-4-one;hydrochloride |
|---|---|
| PubChem CID | 86739859 |
| Molecular Formula | C26H36ClN3O6 |
| Molecular Weight | 522.04 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-5-hydroxyimino-7,8-dimethoxy-1,2-dihydro-3-benzazepin-4-one;hydrochloride |
| SMILES | COc1ccc(CCN(C)CCCN2CCc3cc(OC)c(OC)cc3C(=NO)C2=O)cc1OC.Cl |
| InChI | InChI=1S/C26H35N3O6.ClH/c1-28(13-9-18-7-8-21(32-2)22(15-18)33-3)11-6-12-29-14-10-19-16-23(34-4)24(35-5)17-20(19)25(27-31)26(29)30;/h7-8,15-17,31H,6,9-14H2,1-5H3;1H |
| InChIKey | KHSGWWWANBZOMF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.04 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|