C27H37N3O6 — CID 57295679
3-[3-[2-(3,4-dimethoxy-N-methylanilino)ethyl-methylamino]propyl]-7,8-dimethoxy-1,2-dihydro-3-benzazepine-4,5-dione (PubChem CID 57295679) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dimethoxy-N-methylanilino)ethyl-methylamino]propyl]-7,8-dimethoxy-1,2-dihydro-3-benzazepine-4,5-dione.
| Compound Name | 3-[3-[2-(3,4-dimethoxy-N-methylanilino)ethyl-methylamino]propyl]-7,8-dimethoxy-1,2-dihydro-3-benzazepine-4,5-dione |
|---|---|
| PubChem CID | 57295679 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 3-[3-[2-(3,4-dimethoxy-N-methylanilino)ethyl-methylamino]propyl]-7,8-dimethoxy-1,2-dihydro-3-benzazepine-4,5-dione |
| SMILES | COc1ccc(N(C)CCN(C)CCCN2CCc3cc(OC)c(OC)cc3C(=O)C2=O)cc1OC |
| InChI | InChI=1S/C27H37N3O6/c1-28(14-15-29(2)20-8-9-22(33-3)24(17-20)35-5)11-7-12-30-13-10-19-16-23(34-4)25(36-6)18-21(19)26(31)27(30)32/h8-9,16-18H,7,10-15H2,1-6H3 |
| InChIKey | HHPIGUBCCHLSCD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|