C28H32N2O4 — CID 70386140
7,8-dimethoxy-3-[3-[methyl(1-naphthalen-1-ylethyl)amino]propyl]-1,2-dihydro-3-benzazepine-4,5-dione (PubChem CID 70386140) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 7,8-dimethoxy-3-[3-[methyl(1-naphthalen-1-ylethyl)amino]propyl]-1,2-dihydro-3-benzazepine-4,5-dione.
| Compound Name | 7,8-dimethoxy-3-[3-[methyl(1-naphthalen-1-ylethyl)amino]propyl]-1,2-dihydro-3-benzazepine-4,5-dione |
|---|---|
| PubChem CID | 70386140 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 7,8-dimethoxy-3-[3-[methyl(1-naphthalen-1-ylethyl)amino]propyl]-1,2-dihydro-3-benzazepine-4,5-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=O)N(CCCN(C)C(C)c1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C28H32N2O4/c1-19(22-12-7-10-20-9-5-6-11-23(20)22)29(2)14-8-15-30-16-13-21-17-25(33-3)26(34-4)18-24(21)27(31)28(30)32/h5-7,9-12,17-19H,8,13-16H2,1-4H3 |
| InChIKey | SCMZNMVHORXYAH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|