C23H31N3O4 — CID 19897684
6,7-dimethoxy-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 19897684) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6,7-dimethoxy-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 19897684 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 6,7-dimethoxy-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N(CCCN(C)CCCc1ccc[n+]([O-])c1)CC2 |
| InChI | InChI=1S/C23H31N3O4/c1-24(10-4-7-18-8-5-13-26(28)17-18)11-6-12-25-14-9-19-15-21(29-2)22(30-3)16-20(19)23(25)27/h5,8,13,15-17H,4,6-7,9-12,14H2,1-3H3 |
| InChIKey | FJEKFASACKSEPI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|