C26H35Br2N3O3 — CID 13319962
3-[3-[4-(4-amino-3,5-dibromophenyl)butyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one (PubChem CID 13319962) has the molecular formula C26H35Br2N3O3 and a molecular weight of 597.39 g/mol. Its IUPAC name is 3-[3-[4-(4-amino-3,5-dibromophenyl)butyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one.
| Compound Name | 3-[3-[4-(4-amino-3,5-dibromophenyl)butyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| PubChem CID | 13319962 |
| Molecular Formula | C26H35Br2N3O3 |
| Molecular Weight | 597.39 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | 3-[3-[4-(4-amino-3,5-dibromophenyl)butyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCCN(C)CCCCc1cc(Br)c(N)c(Br)c1)CC2 |
| InChI | InChI=1S/C26H35Br2N3O3/c1-30(9-5-4-7-18-13-21(27)26(29)22(28)14-18)10-6-11-31-12-8-19-15-23(33-2)24(34-3)16-20(19)17-25(31)32/h13-16H,4-12,17,29H2,1-3H3 |
| InChIKey | XAHOKPRKLWRHRA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|