C30H38N2O4 — CID 14099175
7,8-dimethoxy-3-[3-[methyl(4-naphthalen-2-yloxybutyl)amino]propyl]-2,5-dihydro-1H-3-benzazepin-4-one (PubChem CID 14099175) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is 7,8-dimethoxy-3-[3-[methyl(4-naphthalen-2-yloxybutyl)amino]propyl]-2,5-dihydro-1H-3-benzazepin-4-one.
| Compound Name | 7,8-dimethoxy-3-[3-[methyl(4-naphthalen-2-yloxybutyl)amino]propyl]-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| PubChem CID | 14099175 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 7,8-dimethoxy-3-[3-[methyl(4-naphthalen-2-yloxybutyl)amino]propyl]-2,5-dihydro-1H-3-benzazepin-4-one |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCCN(C)CCCCOc1ccc3ccccc3c1)CC2 |
| InChI | InChI=1S/C30H38N2O4/c1-31(14-6-7-18-36-27-12-11-23-9-4-5-10-24(23)19-27)15-8-16-32-17-13-25-20-28(34-2)29(35-3)21-26(25)22-30(32)33/h4-5,9-12,19-21H,6-8,13-18,22H2,1-3H3 |
| InChIKey | GWKKGRPNDKOOTO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|