C22H35BrN2O3 — CID 68860818
4-bromo-2-[4-(dibutylamino)butyl]-5,6-dimethoxy-3H-isoindol-1-one (PubChem CID 68860818) has the molecular formula C22H35BrN2O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is 4-bromo-2-[4-(dibutylamino)butyl]-5,6-dimethoxy-3H-isoindol-1-one.
| Compound Name | 4-bromo-2-[4-(dibutylamino)butyl]-5,6-dimethoxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 68860818 |
| Molecular Formula | C22H35BrN2O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-bromo-2-[4-(dibutylamino)butyl]-5,6-dimethoxy-3H-isoindol-1-one |
| SMILES | CCCCN(CCCC)CCCCN1Cc2c(cc(OC)c(OC)c2Br)C1=O |
| InChI | InChI=1S/C22H35BrN2O3/c1-5-7-11-24(12-8-6-2)13-9-10-14-25-16-18-17(22(25)26)15-19(27-3)21(28-4)20(18)23/h15H,5-14,16H2,1-4H3 |
| InChIKey | FWYFFWBUBODYJQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|