C18H17BrN2O4 — CID 66786920
N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide (PubChem CID 66786920) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide.
| Compound Name | N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 66786920 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide |
| SMILES | COc1cc2c(c(Br)c1OC)CN(CNC(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C18H17BrN2O4/c1-24-14-8-12-13(15(19)16(14)25-2)9-21(18(12)23)10-20-17(22)11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | XZNJOZRVLKMPGH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |