About N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide
N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide (PubChem CID 66786920) has the molecular formula C18H17BrN2O4
and a molecular weight of 405.25 g/mol. Its IUPAC name is N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide.
Molecular Properties
| Compound Name | N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide |
| PubChem CID | 66786920 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide |
| SMILES | COc1cc2c(c(Br)c1OC)CN(CNC(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C18H17BrN2O4/c1-24-14-8-12-13(15(19)16(14)25-2)9-21(18(12)23)10-20-17(22)11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | XZNJOZRVLKMPGH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide?
The IUPAC name of N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide (CID 66786920) is N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide.
What is the SMILES notation for N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide?
The canonical SMILES for N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide is COc1cc2c(c(Br)c1OC)CN(CNC(=O)c1ccccc1)C2=O.
What is the InChIKey of N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide?
The InChIKey is XZNJOZRVLKMPGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN2O4/c1-24-14-8-12-13(15(19)16(14)25-2)9-21(18(12)23)10-20-17(22)11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3,(H,20,22).
What are the key properties of N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide?
N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide has a molecular weight of 405.25 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7-bromo-5,6-dimethoxy-3-oxo-1H-isoindol-2-yl)methyl]benzamide is sourced from PubChem (CID 66786920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).