C9H8O4 — CID 141355094
8-methoxy-1,3-benzodioxin-4-one (PubChem CID 141355094) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 8-methoxy-1,3-benzodioxin-4-one.
| Compound Name | 8-methoxy-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 141355094 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 8-methoxy-1,3-benzodioxin-4-one |
| SMILES | COc1cccc2c1OCOC2=O |
| InChI | InChI=1S/C9H8O4/c1-11-7-4-2-3-6-8(7)12-5-13-9(6)10/h2-4H,5H2,1H3 |
| InChIKey | VQFKNHYWWZELLE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |