C8H6O3S — CID 12563343
4-methoxy-1,3-benzoxathiol-2-one (PubChem CID 12563343) has the molecular formula C8H6O3S and a molecular weight of 182.20 g/mol. Its IUPAC name is 4-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 4-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 12563343 |
| Molecular Formula | C8H6O3S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 4-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cccc2oc(=O)sc12 |
| InChI | InChI=1S/C8H6O3S/c1-10-5-3-2-4-6-7(5)12-8(9)11-6/h2-4H,1H3 |
| InChIKey | ZRDULFYGXFUOLB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |