C8H7NO2S — CID 119088024
7-methoxy-1,2-benzothiazol-3-one (PubChem CID 119088024) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 7-methoxy-1,2-benzothiazol-3-one.
| Compound Name | 7-methoxy-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 119088024 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 7-methoxy-1,2-benzothiazol-3-one |
| SMILES | COc1cccc2c(=O)[nH]sc12 |
| InChI | InChI=1S/C8H7NO2S/c1-11-6-4-2-3-5-7(6)12-9-8(5)10/h2-4H,1H3,(H,9,10) |
| InChIKey | PPRNOWXPQSVXKC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |