C10H11NO2S — CID 117298737
4-(2-aminopropyl)-1,3-benzoxathiol-2-one (PubChem CID 117298737) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-(2-aminopropyl)-1,3-benzoxathiol-2-one.
| Compound Name | 4-(2-aminopropyl)-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117298737 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-(2-aminopropyl)-1,3-benzoxathiol-2-one |
| SMILES | CC(N)Cc1cccc2oc(=O)sc12 |
| InChI | InChI=1S/C10H11NO2S/c1-6(11)5-7-3-2-4-8-9(7)14-10(12)13-8/h2-4,6H,5,11H2,1H3 |
| InChIKey | YTRYCEHKVVLNHV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |