About 6-(2-aminopropyl)-1,3-benzoxathiol-2-one
6-(2-aminopropyl)-1,3-benzoxathiol-2-one (PubChem CID 117298736) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-(2-aminopropyl)-1,3-benzoxathiol-2-one.
Molecular Properties
| Compound Name | 6-(2-aminopropyl)-1,3-benzoxathiol-2-one |
| PubChem CID | 117298736 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-(2-aminopropyl)-1,3-benzoxathiol-2-one |
| SMILES | CC(N)Cc1ccc2sc(=O)oc2c1 |
| InChI | InChI=1S/C10H11NO2S/c1-6(11)4-7-2-3-9-8(5-7)13-10(12)14-9/h2-3,5-6H,4,11H2,1H3 |
| InChIKey | GFMDDWPLWLTJJB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-aminopropyl)-1,3-benzoxathiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminopropyl)-1,3-benzoxathiol-2-one?
The IUPAC name of 6-(2-aminopropyl)-1,3-benzoxathiol-2-one (CID 117298736) is 6-(2-aminopropyl)-1,3-benzoxathiol-2-one.
What is the SMILES notation for 6-(2-aminopropyl)-1,3-benzoxathiol-2-one?
The canonical SMILES for 6-(2-aminopropyl)-1,3-benzoxathiol-2-one is CC(N)Cc1ccc2sc(=O)oc2c1.
What is the InChIKey of 6-(2-aminopropyl)-1,3-benzoxathiol-2-one?
The InChIKey is GFMDDWPLWLTJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-6(11)4-7-2-3-9-8(5-7)13-10(12)14-9/h2-3,5-6H,4,11H2,1H3.
What are the key properties of 6-(2-aminopropyl)-1,3-benzoxathiol-2-one?
6-(2-aminopropyl)-1,3-benzoxathiol-2-one has a molecular weight of 209.27 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminopropyl)-1,3-benzoxathiol-2-one is sourced from PubChem (CID 117298736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).