C13H21N — CID 175188525
1-(2,3-diethylphenyl)propan-2-amine (PubChem CID 175188525) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-(2,3-diethylphenyl)propan-2-amine.
| Compound Name | 1-(2,3-diethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 175188525 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-(2,3-diethylphenyl)propan-2-amine |
| SMILES | CCc1cccc(CC(C)N)c1CC |
| InChI | InChI=1S/C13H21N/c1-4-11-7-6-8-12(9-10(3)14)13(11)5-2/h6-8,10H,4-5,9,14H2,1-3H3 |
| InChIKey | UJRAOAIYFSUJPQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |