About CID 67436949
CID 67436949 (PubChem CID 67436949) has the molecular formula C12H18OSi
and a molecular weight of 206.36 g/mol.
Molecular Properties
| Compound Name | CID 67436949 |
| PubChem CID | 67436949 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | — |
| SMILES | CCc1c(CC(C)C)cccc1[Si]O |
| InChI | InChI=1S/C12H18OSi/c1-4-11-10(8-9(2)3)6-5-7-12(11)14-13/h5-7,9,13H,4,8H2,1-3H3 |
| InChIKey | VSFDXVMWJMXPGU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67436949 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67436949?
The IUPAC name of CID 67436949 (CID 67436949) is not available.
What is the SMILES notation for CID 67436949?
The canonical SMILES for CID 67436949 is CCc1c(CC(C)C)cccc1[Si]O.
What is the InChIKey of CID 67436949?
The InChIKey is VSFDXVMWJMXPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OSi/c1-4-11-10(8-9(2)3)6-5-7-12(11)14-13/h5-7,9,13H,4,8H2,1-3H3.
What are the key properties of CID 67436949?
CID 67436949 has a molecular weight of 206.36 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67436949 is sourced from PubChem (CID 67436949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).