C21H20O7 — CID 134936652
9-ethyl-1,6,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 134936652) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is 9-ethyl-1,6,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 9-ethyl-1,6,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 134936652 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 9-ethyl-1,6,9,11-tetrahydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CCC1(O)CCc2c(O)c3c(c(O)c2C1)C(=O)c1c(O)ccc(OC)c1C3=O |
| InChI | InChI=1S/C21H20O7/c1-3-21(27)7-6-9-10(8-21)18(24)16-15(17(9)23)20(26)14-12(28-2)5-4-11(22)13(14)19(16)25/h4-5,22-24,27H,3,6-8H2,1-2H3 |
| InChIKey | NUCBLKFBPYGPMB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|