C16H12O8 — CID 102138995
1,3,5,6-tetrahydroxy-2-(methoxymethoxy)anthracene-9,10-dione (PubChem CID 102138995) has the molecular formula C16H12O8 and a molecular weight of 332.26 g/mol. Its IUPAC name is 1,3,5,6-tetrahydroxy-2-(methoxymethoxy)anthracene-9,10-dione.
| Compound Name | 1,3,5,6-tetrahydroxy-2-(methoxymethoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 102138995 |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1,3,5,6-tetrahydroxy-2-(methoxymethoxy)anthracene-9,10-dione |
| SMILES | COCOc1c(O)cc2c(c1O)C(=O)c1ccc(O)c(O)c1C2=O |
| InChI | InChI=1S/C16H12O8/c1-23-5-24-16-9(18)4-7-11(15(16)22)12(19)6-2-3-8(17)14(21)10(6)13(7)20/h2-4,17-18,21-22H,5H2,1H3 |
| InChIKey | AASZCAGVBUWQBW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|