C12H17BrO5 — CID 121001110
[2-bromo-3,5-bis(methoxymethoxy)-4-methylphenyl]methanol (PubChem CID 121001110) has the molecular formula C12H17BrO5 and a molecular weight of 321.17 g/mol. Its IUPAC name is [2-bromo-3,5-bis(methoxymethoxy)-4-methylphenyl]methanol.
| Compound Name | [2-bromo-3,5-bis(methoxymethoxy)-4-methylphenyl]methanol |
|---|---|
| PubChem CID | 121001110 |
| Molecular Formula | C12H17BrO5 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | [2-bromo-3,5-bis(methoxymethoxy)-4-methylphenyl]methanol |
| SMILES | COCOc1cc(CO)c(Br)c(OCOC)c1C |
| InChI | InChI=1S/C12H17BrO5/c1-8-10(17-6-15-2)4-9(5-14)11(13)12(8)18-7-16-3/h4,14H,5-7H2,1-3H3 |
| InChIKey | ZEQQLHFHGUGQBP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|