C10H8BrNO4 — CID 154575039
6-bromo-4,5-dimethoxyisoindole-1,3-dione (PubChem CID 154575039) has the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. Its IUPAC name is 6-bromo-4,5-dimethoxyisoindole-1,3-dione.
| Compound Name | 6-bromo-4,5-dimethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 154575039 |
| Molecular Formula | C10H8BrNO4 |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 6-bromo-4,5-dimethoxyisoindole-1,3-dione |
| SMILES | COc1c(Br)cc2c(c1OC)C(=O)NC2=O |
| InChI | InChI=1S/C10H8BrNO4/c1-15-7-5(11)3-4-6(8(7)16-2)10(14)12-9(4)13/h3H,1-2H3,(H,12,13,14) |
| InChIKey | HZCZFZGDXSLHNW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|