C10H9BrO3 — CID 14119827
8-bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one (PubChem CID 14119827) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is 8-bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one.
| Compound Name | 8-bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one |
|---|---|
| PubChem CID | 14119827 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 8-bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one |
| SMILES | COc1ccc(OC)c2c1C(=O)C2Br |
| InChI | InChI=1S/C10H9BrO3/c1-13-5-3-4-6(14-2)8-7(5)9(11)10(8)12/h3-4,9H,1-2H3 |
| InChIKey | YUFIYTCDYLALNS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|