C13H15BrO2 — CID 82024134
6-bromo-1-methoxy-4-methyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 82024134) has the molecular formula C13H15BrO2 and a molecular weight of 283.17 g/mol. Its IUPAC name is 6-bromo-1-methoxy-4-methyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 6-bromo-1-methoxy-4-methyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 82024134 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 6-bromo-1-methoxy-4-methyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | COc1ccc(C)c2c1CCCC(Br)C2=O |
| InChI | InChI=1S/C13H15BrO2/c1-8-6-7-11(16-2)9-4-3-5-10(14)13(15)12(8)9/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | JWVTUOAVCYEIJM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|