C11H12Cl2O — CID 104546666
1,8-dichloro-5-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 104546666) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 1,8-dichloro-5-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1,8-dichloro-5-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 104546666 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1,8-dichloro-5-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccc(Cl)c2c1CCCC2Cl |
| InChI | InChI=1S/C11H12Cl2O/c1-14-10-6-5-9(13)11-7(10)3-2-4-8(11)12/h5-6,8H,2-4H2,1H3 |
| InChIKey | FXGPYKQDKTUKIU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|