C13H17ClO2 — CID 62735651
1-chloro-7,8-dimethoxy-5-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 62735651) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-chloro-7,8-dimethoxy-5-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-7,8-dimethoxy-5-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 62735651 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-chloro-7,8-dimethoxy-5-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc(C)c2c(c1OC)C(Cl)CCC2 |
| InChI | InChI=1S/C13H17ClO2/c1-8-7-11(15-2)13(16-3)12-9(8)5-4-6-10(12)14/h7,10H,4-6H2,1-3H3 |
| InChIKey | XFKFVAKOWXLXNR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|