C12H14Cl2O — CID 104546674
4,5-dichloro-1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 104546674) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 4,5-dichloro-1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 4,5-dichloro-1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 104546674 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 4,5-dichloro-1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | COc1ccc(Cl)c2c1CCCCC2Cl |
| InChI | InChI=1S/C12H14Cl2O/c1-15-11-7-6-10(14)12-8(11)4-2-3-5-9(12)13/h6-7,9H,2-5H2,1H3 |
| InChIKey | FVFPBJRXEGIIKF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|