C15H21BrO — CID 63513368
5-bromo-1-methoxy-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene (PubChem CID 63513368) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-bromo-1-methoxy-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene.
| Compound Name | 5-bromo-1-methoxy-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 63513368 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-bromo-1-methoxy-4,7,7-trimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
| SMILES | COc1ccc(C)c2c1CCC(C)(C)CC2Br |
| InChI | InChI=1S/C15H21BrO/c1-10-5-6-13(17-4)11-7-8-15(2,3)9-12(16)14(10)11/h5-6,12H,7-9H2,1-4H3 |
| InChIKey | YDIRMNIVGMKFOD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|