C12H15ClO2 — CID 62735648
5-chloro-9-methoxy-6-methyl-1,2,4,5-tetrahydro-3-benzoxepine (PubChem CID 62735648) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 5-chloro-9-methoxy-6-methyl-1,2,4,5-tetrahydro-3-benzoxepine.
| Compound Name | 5-chloro-9-methoxy-6-methyl-1,2,4,5-tetrahydro-3-benzoxepine |
|---|---|
| PubChem CID | 62735648 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-chloro-9-methoxy-6-methyl-1,2,4,5-tetrahydro-3-benzoxepine |
| SMILES | COc1ccc(C)c2c1CCOCC2Cl |
| InChI | InChI=1S/C12H15ClO2/c1-8-3-4-11(14-2)9-5-6-15-7-10(13)12(8)9/h3-4,10H,5-7H2,1-2H3 |
| InChIKey | TUTVIEHEDMJCFL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|