C12H14BrClO2 — CID 62735459
6-bromo-5-chloro-9-ethoxy-1,2,4,5-tetrahydro-3-benzoxepine (PubChem CID 62735459) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is 6-bromo-5-chloro-9-ethoxy-1,2,4,5-tetrahydro-3-benzoxepine.
| Compound Name | 6-bromo-5-chloro-9-ethoxy-1,2,4,5-tetrahydro-3-benzoxepine |
|---|---|
| PubChem CID | 62735459 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 6-bromo-5-chloro-9-ethoxy-1,2,4,5-tetrahydro-3-benzoxepine |
| SMILES | CCOc1ccc(Br)c2c1CCOCC2Cl |
| InChI | InChI=1S/C12H14BrClO2/c1-2-16-11-4-3-9(13)12-8(11)5-6-15-7-10(12)14/h3-4,10H,2,5-7H2,1H3 |
| InChIKey | QDZWSJIMWXSXEQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|