C11H10BrFO3 — CID 141333473
2-(6-bromo-3-ethoxy-2-fluorophenyl)-1,3-dioxole (PubChem CID 141333473) has the molecular formula C11H10BrFO3 and a molecular weight of 289.10 g/mol. Its IUPAC name is 2-(6-bromo-3-ethoxy-2-fluorophenyl)-1,3-dioxole.
| Compound Name | 2-(6-bromo-3-ethoxy-2-fluorophenyl)-1,3-dioxole |
|---|---|
| PubChem CID | 141333473 |
| Molecular Formula | C11H10BrFO3 |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-(6-bromo-3-ethoxy-2-fluorophenyl)-1,3-dioxole |
| SMILES | CCOc1ccc(Br)c(C2OC=CO2)c1F |
| InChI | InChI=1S/C11H10BrFO3/c1-2-14-8-4-3-7(12)9(10(8)13)11-15-5-6-16-11/h3-6,11H,2H2,1H3 |
| InChIKey | DTXYQXRDTFPYRS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |