C33H30Br2F6O4Si — CID 160856596
[(6-bromo-2,3-difluorophenyl)-(6-bromo-3-ethoxy-2-fluorophenyl)methoxy]-trimethylsilane;2-ethoxy-1,7,8-trifluoro-9H-fluoren-9-ol (PubChem CID 160856596) has the molecular formula C33H30Br2F6O4Si and a molecular weight of 792.48 g/mol. Its IUPAC name is [(6-bromo-2,3-difluorophenyl)-(6-bromo-3-ethoxy-2-fluorophenyl)methoxy]-trimethylsilane;2-ethoxy-1,7,8-trifluoro-9H-fluoren-9-ol.
| Compound Name | [(6-bromo-2,3-difluorophenyl)-(6-bromo-3-ethoxy-2-fluorophenyl)methoxy]-trimethylsilane;2-ethoxy-1,7,8-trifluoro-9H-fluoren-9-ol |
|---|---|
| PubChem CID | 160856596 |
| Molecular Formula | C33H30Br2F6O4Si |
| Molecular Weight | 792.48 g/mol |
| Exact Mass | 790.02 |
| IUPAC Name | [(6-bromo-2,3-difluorophenyl)-(6-bromo-3-ethoxy-2-fluorophenyl)methoxy]-trimethylsilane;2-ethoxy-1,7,8-trifluoro-9H-fluoren-9-ol |
| SMILES | CCOc1ccc(Br)c(C(O[Si](C)(C)C)c2c(Br)ccc(F)c2F)c1F.CCOc1ccc2c(c1F)C(O)c1c-2ccc(F)c1F |
| InChI | InChI=1S/C18H19Br2F3O2Si.C15H11F3O2/c1-5-24-13-9-7-11(20)15(17(13)23)18(25-26(2,3)4)14-10(19)6-8-12(21)16(14)22;1-2-20-10-6-4-8-7-3-5-9(16)13(17)11(7)15(19)12(8)14(10)18/h6-9,18H,5H2,1-4H3;3-6,15,19H,2H2,1H3 |
| InChIKey | SJYBSAOANLKVKP-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.48 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|