About 6-ethoxy-2,3-difluorobenzonitrile
6-ethoxy-2,3-difluorobenzonitrile (PubChem CID 119017576) has the molecular formula C9H7F2NO
and a molecular weight of 183.16 g/mol. Its IUPAC name is 6-ethoxy-2,3-difluorobenzonitrile.
Molecular Properties
| Compound Name | 6-ethoxy-2,3-difluorobenzonitrile |
| PubChem CID | 119017576 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-ethoxy-2,3-difluorobenzonitrile |
| SMILES | CCOc1ccc(F)c(F)c1C#N |
| InChI | InChI=1S/C9H7F2NO/c1-2-13-8-4-3-7(10)9(11)6(8)5-12/h3-4H,2H2,1H3 |
| InChIKey | ONRJFNBWFGFTQG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethoxy-2,3-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,3-difluorobenzonitrile?
The IUPAC name of 6-ethoxy-2,3-difluorobenzonitrile (CID 119017576) is 6-ethoxy-2,3-difluorobenzonitrile.
What is the SMILES notation for 6-ethoxy-2,3-difluorobenzonitrile?
The canonical SMILES for 6-ethoxy-2,3-difluorobenzonitrile is CCOc1ccc(F)c(F)c1C#N.
What is the InChIKey of 6-ethoxy-2,3-difluorobenzonitrile?
The InChIKey is ONRJFNBWFGFTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2NO/c1-2-13-8-4-3-7(10)9(11)6(8)5-12/h3-4H,2H2,1H3.
What are the key properties of 6-ethoxy-2,3-difluorobenzonitrile?
6-ethoxy-2,3-difluorobenzonitrile has a molecular weight of 183.16 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,3-difluorobenzonitrile is sourced from PubChem (CID 119017576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).