C9H7F2NO — CID 119017576
6-ethoxy-2,3-difluorobenzonitrile (PubChem CID 119017576) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 6-ethoxy-2,3-difluorobenzonitrile.
| Compound Name | 6-ethoxy-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 119017576 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-ethoxy-2,3-difluorobenzonitrile |
| SMILES | CCOc1ccc(F)c(F)c1C#N |
| InChI | InChI=1S/C9H7F2NO/c1-2-13-8-4-3-7(10)9(11)6(8)5-12/h3-4H,2H2,1H3 |
| InChIKey | ONRJFNBWFGFTQG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |