C8H7BF2O3 — CID 139945985
(4-ethoxy-2,3-difluorophenoxy)-oxoborane (PubChem CID 139945985) has the molecular formula C8H7BF2O3 and a molecular weight of 199.95 g/mol. Its IUPAC name is (4-ethoxy-2,3-difluorophenoxy)-oxoborane.
| Compound Name | (4-ethoxy-2,3-difluorophenoxy)-oxoborane |
|---|---|
| PubChem CID | 139945985 |
| Molecular Formula | C8H7BF2O3 |
| Molecular Weight | 199.95 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (4-ethoxy-2,3-difluorophenoxy)-oxoborane |
| SMILES | CCOc1ccc(OB=O)c(F)c1F |
| InChI | InChI=1S/C8H7BF2O3/c1-2-13-5-3-4-6(14-9-12)8(11)7(5)10/h3-4H,2H2,1H3 |
| InChIKey | KDAQRYLKAUDPDX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.95 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|