C7H2F3NO — CID 153457269
(2,3,4-trifluorophenyl) cyanate (PubChem CID 153457269) has the molecular formula C7H2F3NO and a molecular weight of 173.09 g/mol. Its IUPAC name is (2,3,4-trifluorophenyl) cyanate.
| Compound Name | (2,3,4-trifluorophenyl) cyanate |
|---|---|
| PubChem CID | 153457269 |
| Molecular Formula | C7H2F3NO |
| Molecular Weight | 173.09 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | (2,3,4-trifluorophenyl) cyanate |
| SMILES | N#COc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H2F3NO/c8-4-1-2-5(12-3-11)7(10)6(4)9/h1-2H |
| InChIKey | JQDMCEOCBKNPKE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.09 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|