About (3-chloro-4-fluorophenyl) cyanate;ethane
(3-chloro-4-fluorophenyl) cyanate;ethane (PubChem CID 142304559) has the molecular formula C9H9ClFNO
and a molecular weight of 201.63 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl) cyanate;ethane.
Molecular Properties
| Compound Name | (3-chloro-4-fluorophenyl) cyanate;ethane |
| PubChem CID | 142304559 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (3-chloro-4-fluorophenyl) cyanate;ethane |
| SMILES | CC.N#COc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C7H3ClFNO.C2H6/c8-6-3-5(11-4-10)1-2-7(6)9;1-2/h1-3H;1-2H3 |
| InChIKey | YUCLNGKGTDTCSQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4-fluorophenyl) cyanate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-fluorophenyl) cyanate;ethane?
The IUPAC name of (3-chloro-4-fluorophenyl) cyanate;ethane (CID 142304559) is (3-chloro-4-fluorophenyl) cyanate;ethane.
What is the SMILES notation for (3-chloro-4-fluorophenyl) cyanate;ethane?
The canonical SMILES for (3-chloro-4-fluorophenyl) cyanate;ethane is CC.N#COc1ccc(F)c(Cl)c1.
What is the InChIKey of (3-chloro-4-fluorophenyl) cyanate;ethane?
The InChIKey is YUCLNGKGTDTCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClFNO.C2H6/c8-6-3-5(11-4-10)1-2-7(6)9;1-2/h1-3H;1-2H3.
What are the key properties of (3-chloro-4-fluorophenyl) cyanate;ethane?
(3-chloro-4-fluorophenyl) cyanate;ethane has a molecular weight of 201.63 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-fluorophenyl) cyanate;ethane is sourced from PubChem (CID 142304559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).