C12H7Cl3FNO — CID 106891029
3,5-dichloro-4-(3-chloro-4-fluorophenoxy)aniline (PubChem CID 106891029) has the molecular formula C12H7Cl3FNO and a molecular weight of 306.55 g/mol. Its IUPAC name is 3,5-dichloro-4-(3-chloro-4-fluorophenoxy)aniline.
| Compound Name | 3,5-dichloro-4-(3-chloro-4-fluorophenoxy)aniline |
|---|---|
| PubChem CID | 106891029 |
| Molecular Formula | C12H7Cl3FNO |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 3,5-dichloro-4-(3-chloro-4-fluorophenoxy)aniline |
| SMILES | Nc1cc(Cl)c(Oc2ccc(F)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl3FNO/c13-8-5-7(1-2-11(8)16)18-12-9(14)3-6(17)4-10(12)15/h1-5H,17H2 |
| InChIKey | PSPGWWFLJRIFOJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|