C13H10Cl3NO — CID 106891037
3,5-dichloro-4-(5-chloro-2-methylphenoxy)aniline (PubChem CID 106891037) has the molecular formula C13H10Cl3NO and a molecular weight of 302.59 g/mol. Its IUPAC name is 3,5-dichloro-4-(5-chloro-2-methylphenoxy)aniline.
| Compound Name | 3,5-dichloro-4-(5-chloro-2-methylphenoxy)aniline |
|---|---|
| PubChem CID | 106891037 |
| Molecular Formula | C13H10Cl3NO |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 3,5-dichloro-4-(5-chloro-2-methylphenoxy)aniline |
| SMILES | Cc1ccc(Cl)cc1Oc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO/c1-7-2-3-8(14)4-12(7)18-13-10(15)5-9(17)6-11(13)16/h2-6H,17H2,1H3 |
| InChIKey | QDCCOOBSOBFVBL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|