C18H17F3OS2 — CID 143128157
2-ethoxy-1,7,8-trifluoro-9-(2-methylsulfanylethylsulfanyl)-9H-fluorene (PubChem CID 143128157) has the molecular formula C18H17F3OS2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-ethoxy-1,7,8-trifluoro-9-(2-methylsulfanylethylsulfanyl)-9H-fluorene.
| Compound Name | 2-ethoxy-1,7,8-trifluoro-9-(2-methylsulfanylethylsulfanyl)-9H-fluorene |
|---|---|
| PubChem CID | 143128157 |
| Molecular Formula | C18H17F3OS2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-ethoxy-1,7,8-trifluoro-9-(2-methylsulfanylethylsulfanyl)-9H-fluorene |
| SMILES | CCOc1ccc2c(c1F)C(SCCSC)c1c-2ccc(F)c1F |
| InChI | InChI=1S/C18H17F3OS2/c1-3-22-13-7-5-11-10-4-6-12(19)16(20)14(10)18(15(11)17(13)21)24-9-8-23-2/h4-7,18H,3,8-9H2,1-2H3 |
| InChIKey | WOMLQQRCHMYQAF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|