About 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine
8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine (PubChem CID 22498498) has the molecular formula C10H11BrO3
and a molecular weight of 259.10 g/mol. Its IUPAC name is 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine.
Molecular Properties
| Compound Name | 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine |
| PubChem CID | 22498498 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine |
| SMILES | CCOc1ccc(Br)c2c1CCOO2 |
| InChI | InChI=1S/C10H11BrO3/c1-2-12-9-4-3-8(11)10-7(9)5-6-13-14-10/h3-4H,2,5-6H2,1H3 |
| InChIKey | KMEUZPZDMPZVOM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine?
The IUPAC name of 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine (CID 22498498) is 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine.
What is the SMILES notation for 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine?
The canonical SMILES for 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine is CCOc1ccc(Br)c2c1CCOO2.
What is the InChIKey of 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine?
The InChIKey is KMEUZPZDMPZVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO3/c1-2-12-9-4-3-8(11)10-7(9)5-6-13-14-10/h3-4H,2,5-6H2,1H3.
What are the key properties of 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine?
8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine has a molecular weight of 259.10 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-ethoxy-3,4-dihydro-1,2-benzodioxine is sourced from PubChem (CID 22498498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).