C13H17BrO2 — CID 79837496
1-bromo-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroindene (PubChem CID 79837496) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is 1-bromo-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroindene.
| Compound Name | 1-bromo-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 79837496 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-bromo-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroindene |
| SMILES | COc1ccc(OC)c2c1C(Br)CC2(C)C |
| InChI | InChI=1S/C13H17BrO2/c1-13(2)7-8(14)11-9(15-3)5-6-10(16-4)12(11)13/h5-6,8H,7H2,1-4H3 |
| InChIKey | MGUXUZITSNMWHN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|