C13H19NO2 — CID 79837934
(1S)-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroinden-1-amine (PubChem CID 79837934) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (1S)-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroinden-1-amine.
| Compound Name | (1S)-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79837934 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1S)-4,7-dimethoxy-3,3-dimethyl-1,2-dihydroinden-1-amine |
| SMILES | COc1ccc(OC)c2c1[C@@H](N)CC2(C)C |
| InChI | InChI=1S/C13H19NO2/c1-13(2)7-8(14)11-9(15-3)5-6-10(16-4)12(11)13/h5-6,8H,7,14H2,1-4H3/t8-/m0/s1 |
| InChIKey | BZNWNYFHKLQCCR-QMMMGPOBSA-N |
| XLogP | 2.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |