C15H21BrO2 — CID 63515124
5-bromo-2,3-dimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene (PubChem CID 63515124) has the molecular formula C15H21BrO2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 5-bromo-2,3-dimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene.
| Compound Name | 5-bromo-2,3-dimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 63515124 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 5-bromo-2,3-dimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulene |
| SMILES | COc1cc2c(cc1OC)C(Br)CC(C)(C)CC2 |
| InChI | InChI=1S/C15H21BrO2/c1-15(2)6-5-10-7-13(17-3)14(18-4)8-11(10)12(16)9-15/h7-8,12H,5-6,9H2,1-4H3 |
| InChIKey | LKJZIDSJNAYZIF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|