C16H21Br — CID 115483281
5-bromo-7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]indene (PubChem CID 115483281) has the molecular formula C16H21Br and a molecular weight of 293.25 g/mol. Its IUPAC name is 5-bromo-7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]indene.
| Compound Name | 5-bromo-7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]indene |
|---|---|
| PubChem CID | 115483281 |
| Molecular Formula | C16H21Br |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-bromo-7,7-dimethyl-2,3,5,6,8,9-hexahydro-1H-cyclohepta[f]indene |
| SMILES | CC1(C)CCc2cc3c(cc2C(Br)C1)CCC3 |
| InChI | InChI=1S/C16H21Br/c1-16(2)7-6-13-8-11-4-3-5-12(11)9-14(13)15(17)10-16/h8-9,15H,3-7,10H2,1-2H3 |
| InChIKey | VYAUCPOLLUSYFW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|